Question

In: Chemistry

Draw the organic product for the following reaction. Omit any inorganic byproducts or ions.

Draw the organic product for the following reaction. Omit any inorganic byproducts or ions.

Solutions

Expert Solution

Concepts and reason

The concept used to solve this question is to use the functioning of the given reagent LiAlH4\operatorname{LiAlH}_{4}. It is a reducing agent and is used in the reduction of a wide variety of functional groups. The given starting material is an amide, so the product formed by the reduction of amide in the presence of LiAlH4\operatorname{LiAlH}_{4} is the answer.

Fundamentals

Organic chemistry is a chemistry branch that deals with the synthesis of scaffolds using different reagents by taking a specific synthetic route. Every reagent has a specific application that can be used in the synthesis for the functional group transformation. The functional group in the compounds decides the reactivity of the compounds. The given reagent is LiAlH4\operatorname{LiAlH}_{4}. The systematic name of this reagent is lithium aluminum hydride. The structure of liAlH4\operatorname{liAlH}_{4} is as follows:

From the name itself, it is clear that it consists of a hydride ion, ready to attack the electron-deficient site of the compounds. So it acts as a reducing agent. It is used to reduce a wide variety of functional groups like carboxylic acid and their derivatives, carbonyl compounds, nitro compounds, nitrile compounds, and so on. The reactions of carboxylic acid and their derivatives with LiAlH4\operatorname{LiAlH}_{4} are shown below.

Hence, the formation of product in the LiAlH 4_{4} reaction depends on the functional group present on the starting material.

 

The structure of the starting material is shown below.

In the above structure, the carbon atom of the C=O bond is bonded to a nitrogen atom, so it is an amide bond. Thus, the given compound is a cyclic amide, which is also called lactam.

 

Therefore, the functional group present in the starting material is the “amide” functional group.

To write the reaction's product, one should know the functional group present in the starting material. From the structure of the starting material, it is observed that an amide functional group is present. So, the given compound is a cyclic amide.

 

The given starting material is an aromatic lactam, and it consists of an amide functional group. According to reactions of LiAlH4\operatorname{LiAlH}_{4} with the carboxylic acid derivatives, when an amide is treated with LiAlH4,\operatorname{LiAlH}_{4}, the carbonyl bond (C=O)(\mathrm{C}=\mathrm{O}) of amide is reduced to CH2\mathrm{CH}_{2} group and forms an amine as product. Therefore, the given reaction can be written as follows:

Thus, the organic product of the given reaction is shown below.

The functional group present in the starting material is an amide functional group. The reagent given in the reaction is LiAlH4\operatorname{LiAlH}_{4}. liAlH4\operatorname{liAlH}_{4} is a reducing agent, so it reduces the amide functional group into an amine. Thus, the cyclic amide on treatment with LiAlH 4_{4} undergoes reduction followed by hydrolysis gives cyclic amine as the product.


The organic product of the given reaction is as follows:

Related Solutions

Draw the organic product in each of the following reactions. Include formal charges, if applicable. Omit any inorganic byproducts or ions.
Draw the organic product in each of the following reactions. Include formal charges, if applicable. Omit any inorganic byproducts or ions.  
Draw the structures of organic compounds A and B. Omit all of the byproducts.
Draw the structures of organic compounds A and B. Omit all of the byproducts. acetaldehyde H2O  
For the following SN2 reaction, draw the organic and inorganic products of the reaction, and identify...
For the following SN2 reaction, draw the organic and inorganic products of the reaction, and identify the nucleophile, substrate, and leaving group. Ch3Br + CH3C≡ C:–
For the following SN2 reaction, draw the organic and inorganic products of the reaction, and identify the nucleophile, substrate, and leaving group.
For the following SN2 reaction, draw the organic and inorganic products of the reaction, and identify the nucleophile, substrate, and leaving group. Select the statement that properly identifies the nucleophile, substrate, and leaving group.  Br- is the substrate, CH3C≡C:- is the nucleophile, and CH3Br- is the leaving group.  CH3Br-  is the substrate, CH3C≡C:- is the nucleophile, and Br- is the leaving group  CH3C≡C:-  is the substrate, CH3Br-  is the nucleophile, and Br- is the leaving group
For the following SN2 reaction, draw the organic and inorganic products of the reaction, and identify the nucleophile, substrate, and leaving group.
For the following SN2 reaction, draw the organic and inorganic products of the reaction, and identify the nucleophile, substrate, and leaving group.Select the statement that properly identifies the nucleophile, substrate, and leaving group. I- is the substrate, NH2- is the nucleophile, and CH3l is the leaving group. CH3l is the substrate, NH2-  is the nucleophile, and is the leaving group. NH2-  is the substrate, CH3l is the nucleophile, and is the leaving group. 
Draw the major organic product of the reaction shown below.Draw the major organic product of...
Draw the major organic product of the reaction shown below. Draw the major organic product of the reaction shown below.  
Draw the structure of the organic product of each reaction in the following two-step synthesis.
Draw the structure of the organic product of each reaction in the following two-step synthesis.  
Draw the organic product (if any) expected from the following reaction: (include all hydrogen atoms) CH3CH2CH2OH + K2Cr2O7(aq) H2SO4
Draw the organic product (if any) expected from the following reaction: (include all hydrogen atoms)  CH3CH2CH2OH+K2Cr2O7(aq)H2SO4 Note: K2Cr2O7 is present in excess.  \begin{aligned} &\mathrm{CH}_{3} \mathrm{CH}_{2} \mathrm{CH}_{2} \mathrm{OH}+\mathrm{K}_{2} \mathrm{Cr}_{2} \mathrm{O}_{7}(a q) \stackrel{\mathrm{H}_{2} \mathrm{SO}_{4}}{\longrightarrow}\\ &\text { Note: } \mathrm{K}_{2} \mathrm{Cr}_{2} \mathrm{O}_{7} \text { is present in excess. } \end{aligned}
Draw the organic products formed in the following reaction.
Draw the organic products formed in the following reaction.
ADVERTISEMENT
ADVERTISEMENT
ADVERTISEMENT