Question

In: Chemistry

1. 3. Consider the dissociation of acetic acid: CH3COOH(aq) + H2O(l) ⎯→ ←⎯ CH3COO-(aq) + H3O+(aq)...

1. 3. Consider the dissociation of acetic acid: CH3COOH(aq) + H2O(l) ⎯→ ←⎯ CH3COO-(aq) + H3O+(aq) Ka = 1.8 x 10-5    pKa = 4.74

a. Write the equilibrium expression.

b. Would the addition of an aqueous solution of sodium hydroxide favor the dissociation of acetic acid? Explain your answer.

c. Would the addition of an aqueous solution of sodium acetate favor the dissociation of acetic acid? Explain your answer.

Solutions

Expert Solution

The dissociation equation is

CH3COOH (aq) + H2O (l) ------> CH3COO- (aq) + H3O+ (aq)

Ka = 1.8*10-5, pKa = 4.74

a) The expression for equilibrium constant is

K = [CH3COO-][H3O+]/[CH3COOH] (H2O, l is present in large excess and hence not included in the expression for K).

b) Write out the equation that would take place:

CH3COOH (aq) + NaOH (aq) ------> CH3COO-Na+ (aq) + H2O (l)

H+ (aq) + OH- (aq) -----> H2O (l)

As aqueous NaOH is added to acetic acid, neutralization of acetic acid to form sodium acetate (acetate is the conjugate base of acetic acid) and water takes place. As more NaOH is added, more acetate and water are formed. Water is removed from the system and hence H+ (or H3O+) concentration decreases. To keep K constant, therefore, acetic acid should undergo further dissociation and furnish more H3O+.

b) Sodium acetate reacts with water as

CH3COO- (aq) + H2O (l) -------> CH3COOH (aq) + OH-(aq)

The reaction produces more CH3COOH. K must remain constant as the temperature is kept constant. Hence, to keep K constant, the numerator must increase and hence acetic acid will undergo further dissociation.


Related Solutions

The deprotonation of acetic acid goes by the mechanism CH3COOH + H2O ⇒ CH3COO– + H3O+...
The deprotonation of acetic acid goes by the mechanism CH3COOH + H2O ⇒ CH3COO– + H3O+ Assume the pKa of acetic acid at 25°C is 4.76, and the forward rate at a pH of 4 is 102 s–1. (a) Calculate the forward and reverse rate constants for the reaction. (b) Calculate the relaxation time if a 10–2 M solution of solution of acetate in water at pH 6 is subjected to a temperature jump. (c) Given reasonable estimates for molecular...
1a. CH3COOH (aq) + H2O (l)  ⇌  CH3COO- (aq) + H3O+ (aq) If the K value for this...
1a. CH3COOH (aq) + H2O (l)  ⇌  CH3COO- (aq) + H3O+ (aq) If the K value for this equilibrium is 1.80 X 10-5, what is the pH of a 1.45 M solution of CH3COOH? (refer to above net equation) 1b. CH3COO- (aq) + H2O (l)  ⇌  CH3COOH (aq) + OH- (aq) If the Keq for CH3COOH is 1.80 X 10-5, what is the pH of a 0.25 M solution of CH3COONa? Hint: This K value is not the one you need.
Dissociation Constant For the dissociation reaction of a weak acid in water, HA(aq)+H2O(l)?H3O+(aq)+A?(aq) the equilibrium constant...
Dissociation Constant For the dissociation reaction of a weak acid in water, HA(aq)+H2O(l)?H3O+(aq)+A?(aq) the equilibrium constant is the acid-dissociation constant, Ka, and takes the form Ka=[H3O+][A?][HA] Weak bases accept a proton from water to give the conjugate acid and OH? ions: B(aq)+H2O(l)?BH+(aq)+OH?(aq) The equilibrium constant Kb is called the base-dissociation constant and can be found by the formula Kb=[BH+][OH?][B] When solving equilibrium-based expression, it is often helpful to keep track of changing concentrations is through what is often called an...
At 25 ∘C phosphoric acid, H3PO4, has the following equilibrium constants: H3PO4(aq)+H2O(l)H2PO4−(aq)+H2O(l)HPO42−(aq)+H2O(l)⇌⇌⇌H3O+(aq)+H2PO−4(aq)H3O+(aq)+HPO42−(aq)H3O+(aq)+PO43−(aq What is the pH...
At 25 ∘C phosphoric acid, H3PO4, has the following equilibrium constants: H3PO4(aq)+H2O(l)H2PO4−(aq)+H2O(l)HPO42−(aq)+H2O(l)⇌⇌⇌H3O+(aq)+H2PO−4(aq)H3O+(aq)+HPO42−(aq)H3O+(aq)+PO43−(aq What is the pH of a solution of 0.300 M K2HPO4, potassium hydrogen phosphate? Express your answer numerically to the hundredths place. What is the pH of a solution of 0.700 M KH2PO4, potassium dihydrogen phosphate? Express your answer numerically to the hundredths place.
10. What is the [CH3COOH ]/[CH3COO– ] ratio in an acetic acid/sodium acetate buffer at pH...
10. What is the [CH3COOH ]/[CH3COO– ] ratio in an acetic acid/sodium acetate buffer at pH = 4.90? (Ka = 1.8 x 10–5 ) a. 0.31 b. 0.70 c. 1.45 d. 2.41 e. 4.90 11. How many grams of NaCH3COO should be added to 250 mL of 0,100 M CH3COOH when the above solution is prepared? a. 0.431 g b. 2.95 g c. 5.66 g d. 1.43 g e.11.9 g
Consider the following reaction: HC2H3O2(aq)+H2O(l)?H3O+(aq)+C2H3O?2(aq) Kc=1.8
Consider the following reaction: HC2H3O2(aq)+H2O(l)?H3O+(aq)+C2H3O?2(aq) Kc=1.8
CH3COOH + NaHCO3 --> H2O + CHCOONa + CO2 Question 1.) The moles of acetic acid...
CH3COOH + NaHCO3 --> H2O + CHCOONa + CO2 Question 1.) The moles of acetic acid in 70.0 mL of 0.833 M acetic acid solution is ___ moles. <-- 0.0583 moles ? The formula mass of NaHCO3 is 84.01 g/mol. Use this to calculate the moles of NaHCO3 below: Trial 1:  2.40 g NaHCO3 contains ___ moles? <-- 0.0286 moles ? Trial 2: 3.60 g NaHCO3 contains___ moles? <-- 0.0429 moles ? Trial 3: 4.80 g NaHCO3 contains ___ moles? <--...
How would i determine the Enthalpy of Dissociation for CH3COOH --> CH3COO- + H+ from the...
How would i determine the Enthalpy of Dissociation for CH3COOH --> CH3COO- + H+ from the data of NaOH + HCl --> NaCl + H2O Delta H = -59.4 Kj/mol NaOH + CH3COOH --> NaCH3COO + H2O Delta H = -51.6 Kj/mol
Reaction 1: NH4+(aq) + H2O(l)NH3 + H3O+(aq) pKA = 9.2 the system described above, it has...
Reaction 1: NH4+(aq) + H2O(l)NH3 + H3O+(aq) pKA = 9.2 the system described above, it has been found that the activity coefficients for the species in solution are: (NH4+) = 0.80, (H3O+) = 0.90, (OH-) = 0.88 – the activity coefficients for neutral molecules are 1.0. a.) Write down the equilibrium expression for Reaction 1 in terms of activity coefficients and concentrations – i.e. the correct equilibrium expression which is NOT just in terms of concentrations. b.) Now algebraically manipulate...
Consider the titration of a 12.0 mL solution containing 0.200 mol/L acetic acid (CH3COOH, Ka =...
Consider the titration of a 12.0 mL solution containing 0.200 mol/L acetic acid (CH3COOH, Ka = 1.8 x 10-5 ), with a solution of 0.250 mol/L KOH. (12 points total) i) Determine the pH of the solution when 4.80 mL of KOH has been added. ii) Determine the pH of the solution when 14.00 mL of KOH has been added.
ADVERTISEMENT
ADVERTISEMENT
ADVERTISEMENT