Consider the bromination of 1-pentanol by HBr to form 1-bromopentane. CH3(CH2)3CH2OH + HBr ---> CH3(CH2)3CH2Br +...

Consider the bromination of 1-pentanol by HBr to form 1-bromopentane.

CH3(CH2)3CH2OH + HBr ---> CH3(CH2)3CH2Br + H2O

1 pentanol mol. weight 88 g/mol

hydrobromic acid 80.9 g/mol

1-bromopentane 151 g/mol

nitric acid 63 g/mol

a) If you had 44 g of 1-pentanol, 34 g of HBr and 1.7 g of nitric acid, what would be the limiting reagent in this reaction?

b) What is the theoretical yield of 1-bromopentane in (a) ?

c) If you obtained 16.0 g of 1-bromopentane, what is the % yield for the reaction?

Expert Solution

queen_honey_blossom answered 2 years ago

For the gas phase decomposition of isobutyl bromide, (CH3)2CHCH2Br----->(CH3)2C=CH2 + HBr the rate constant has been...

For the gas phase decomposition of isobutyl bromide, (CH3)2CHCH2Br----->(CH3)2C=CH2 + HBr the rate constant has been determined at several temperatures. When ln k in s-1 is plotted against the reciprocal of the Kelvin temperature, the resulting linear plot has a slope of -2.54×104 K and a y-intercept of 30.1. The activation energy for the gas phase decomposition of isobutyl bromide is kJ/mol

What is the IUPAC name for the compound shown below? H3C-CH2-CH2-CH2-CH(-CH2-CH2-CH3)-CH2-CH2-CH3 (The parenthesis mean it is...

What is the IUPAC name for the compound shown below? H3C-CH2-CH2-CH2-CH(-CH2-CH2-CH3)-CH2-CH2-CH3 (The parenthesis mean it is branched.)

hybridization of H2C=CH-CH2-CH3

Name the compound: (CH3)3N_ What is the name of CH3(CH2)6COOH? ________ The reaction of a carboxylic...

Name the compound: (CH3)3N_______ What is the name of CH3(CH2)6COOH? ______________ The reaction of a carboxylic acid with an alcohol in the presence of strong acid produces________________ What are the products of the reaction of pentanoic acid with the strong base potassium hydroxide? _____________

1)The activation energy for the gas phase decomposition of t-butyl propionate is 164 kJ. C2H5COOC(CH3)3(CH3)2C=CH2 +...

1)The activation energy for the gas phase decomposition of t-butyl propionate is 164 kJ. C2H5COOC(CH3)3(CH3)2C=CH2 + C2H5COOH The rate constant at 536 K is 6.91×10-4 /s. The rate constant will be 4.12×10-3 /s at K. 2)The activation energy for the gas phase decomposition of t-butyl propionate is 164 kJ. C2H5COOC(CH3)3(CH3)2C=CH2 + C2H5COOH The rate constant at 540 K is 9.02×10-4 /s. The rate constant will be /s at 584 K. 3) For the gas phase decomposition of t-butyl propionate, C2H5COOC(CH3)3(CH3)2C=CH2 + C2H5COOH...

When 1,3-butadiene (CH2=CH–CH=CH2) is treated with HBr, two constitutional isomers are formed, CH3CHBrCH=CH2 and BrCH2CH=CHCH3. Explain...

When 1,3-butadiene (CH2=CH–CH=CH2) is treated with HBr, two constitutional isomers are formed, CH3CHBrCH=CH2 and BrCH2CH=CHCH3. Explain and draw a stepwise mechanism that accounts for the formation of both products.

What is the Pople Notation of the ethyl group in ethanol CH3-CH2-OH

1.Determine the number of moles of ATP that can be synthesized from one mole of CH3(CH2)22COOH....

1.Determine the number of moles of ATP that can be synthesized from one mole of CH3(CH2)22COOH. (Show all your work.) 2.Why does the oxidation of unsaturated fatty acids such as oleic acid require additional enzymes? How does the presence of a carbon-carbon double bond change the total number of ATP that can be produced?

O2, CO2, HCl, NaCl, CH4, C8H18, CH3CH2OH, (CH3)2CHNH3 +Cl- , CH3(CH2)6OH. Find and compare their molar...

O2, CO2, HCl, NaCl, CH4, C8H18, CH3CH2OH, (CH3)2CHNH3 +Cl- , CH3(CH2)6OH. Find and compare their molar solubilities (mol/L) in water at ambient conditions. Briefly discuss how solubility is related to molecular structure. Describe possible effects of raising temperature and pressure on solubility of these species.

Which of the molecules below is the strongest base? CH3O- (CH2)2N- Cl- HO- (CH3)2NH

Question