Question

In: Chemistry

For the gas phase decomposition of isobutyl bromide, (CH3)2CHCH2Br----->(CH3)2C=CH2 + HBr the rate constant has been...

For the gas phase decomposition of isobutyl bromide,

(CH3)2CHCH2Br----->(CH3)2C=CH2 + HBr


the rate constant has been determined at several temperatures. When ln k in s-1 is plotted against the reciprocal of the Kelvin temperature, the resulting linear plot has a slope of -2.54×104 K and a y-intercept of 30.1.

The activation energy for the gas phase decomposition of isobutyl bromide is  kJ/mol

Solutions

Expert Solution

queen_honey_blossom answered 2 years ago
Next > < Previous

Related Solutions

1)The activation energy for the gas phase decomposition of t-butyl propionate is 164 kJ. C2H5COOC(CH3)3(CH3)2C=CH2 +...
1)The activation energy for the gas phase decomposition of t-butyl propionate is 164 kJ. C2H5COOC(CH3)3(CH3)2C=CH2 + C2H5COOH The rate constant at 536 K is 6.91×10-4 /s. The rate constant will be 4.12×10-3 /s at  K. 2)The activation energy for the gas phase decomposition of t-butyl propionate is 164 kJ. C2H5COOC(CH3)3(CH3)2C=CH2 + C2H5COOH The rate constant at 540 K is 9.02×10-4 /s. The rate constant will be  /s at 584 K. 3) For the gas phase decomposition of t-butyl propionate, C2H5COOC(CH3)3(CH3)2C=CH2 + C2H5COOH...
Consider the bromination of 1-pentanol by HBr to form 1-bromopentane. CH3(CH2)3CH2OH + HBr ---> CH3(CH2)3CH2Br +...
Consider the bromination of 1-pentanol by HBr to form 1-bromopentane. CH3(CH2)3CH2OH + HBr ---> CH3(CH2)3CH2Br + H2O 1 pentanol mol. weight 88 g/mol hydrobromic acid 80.9 g/mol 1-bromopentane 151 g/mol nitric acid 63 g/mol a) If you had 44 g of 1-pentanol, 34 g of HBr and 1.7 g of nitric acid, what would be the limiting reagent in this reaction? b) What is the theoretical yield of 1-bromopentane in (a) ? c) If you obtained 16.0 g of 1-bromopentane,...
for the gas phase isomerization of dimethyl maleate, the rate constant in s-1 has been determined...
for the gas phase isomerization of dimethyl maleate, the rate constant in s-1 has been determined at several temperatures. when ln k is plotted against the reciprocal of the Kelvin temperature, the resulting linear plot has a slope of -1.34 x 104 K and a y-intercept of 11.8. The value of the rate constant for the gas phase isomerization of dimethyl maleate at 683 K is _ s-1 enter your answer to one significant figure
The gas phase decomposition of hydrogen iodide to hydrogen gas and iodine gas occurs with a...
The gas phase decomposition of hydrogen iodide to hydrogen gas and iodine gas occurs with a rate of 2.35x10^-7 M^-1s^-1 at 283 degree C and 1.62x10^-3 M^-1s^-1 at 427 degree C. A. What is the activation energy of this reaction in kJ/mole? B. What is the temperature in Celsius of a reaction that has a rate constant of 2.91x10^-4 M^-1s^-1?
Rate constants for the gas-phase decomposition of hydrogen iodide, 2 HI(g) → H2 (g) + I2...
Rate constants for the gas-phase decomposition of hydrogen iodide, 2 HI(g) → H2 (g) + I2 (g), are listed in the following table: Temperature (Celcius) k(M-1s-1) 283 3.52*10-7 356 3.02*10-5 393 2.19*10-4 427 1.16*10-3 508 3.95*10-2 (a) Find the activation energy (in kJ/mol) using all five data points. (b) Calculate Ea from the rate constants at 283 °C and 508 °C. (c) Given the rate constant at 283 °C and the value of Ea obtained in part (b), what is...
The decomposition of XY is second order in XYand has a rate constant of 7.20
The decomposition of XY is second order in XYand has a rate constant of 7.20
In zero reaction, the decomposition of ammonia gas on a tungsten surface has a rate of...
In zero reaction, the decomposition of ammonia gas on a tungsten surface has a rate of 22.3 x10-4 moles liter-1 minute-1 at 1100 K when the concentration of the NH3 = 0.01M a. Why doubling the concentration of the ammonia has no effect on the rate of the reaction. Why this happens. c. What is the concentration of the ammonia after 30 minutes have elapsed? d. How long will it take for the concentration of the ammonia to drop to...
The gas phase reaction           2A + B →2C is   carried   out   isothermally   and   isobarically.   The   reaction  ...
The gas phase reaction           2A + B →2C is   carried   out   isothermally   and   isobarically.   The   reaction   is    first    order    in    A    and    first order in B. The feed is equal molar in A and B and the entering concentration of A is 0.5 mol/dm3. The specific reaction rate is k = 4.0 dm3/mol s. Write   the   rate   of   reaction,   –rA,   solely   as   a   function   of   conversion,    evaluating    all    parameters.
The gas phase reaction           2A + B →2C is   carried   out   isothermally   and   isobarically.   The   reaction  ...
The gas phase reaction           2A + B →2C is   carried   out   isothermally   and   isobarically.   The   reaction   is    first    order    in    A    and    first order in B. The feed is equal molar in A and B and the entering concentration of A is 0.5 mol/dm3. The specific reaction rate is k = 4.0 dm3/mol s. Write   the   rate   of   reaction,   –rA,   solely   as   a   function   of   conversion,    evaluating    all    parameters.
The gas phase reaction H2 + I2 --> 2HI is second order. Its rate constant at...
The gas phase reaction H2 + I2 --> 2HI is second order. Its rate constant at 400 C is 0.0243 dm3/mol s. Calculate delta H, delta S, delta G and the pre-exponential at this temperature. Assume that delta H is constant over this temperature range.
ADVERTISEMENT
Subjects
ADVERTISEMENT
Latest Questions
ADVERTISEMENT