Question
In: Chemistry
For the gas phase decomposition of isobutyl bromide, (CH3)2CHCH2Br----->(CH3)2C=CH2 + HBr the rate constant has been...
For the gas phase decomposition of
isobutyl bromide,
(CH3)2CHCH2Br----->(CH3)2C=CH2 + HBr
the rate constant has been determined at several temperatures. When
ln k in s-1 is plotted against the reciprocal of the
Kelvin temperature, the resulting linear plot has a slope of
-2.54×104 K and a y-intercept of
30.1.
The activation energy for the gas phase
decomposition of isobutyl bromide
is kJ/mol
Solutions
queen_honey_blossom answered 2 years agoRelated Solutions
1)The activation energy for the gas phase decomposition of t-butyl propionate is 164 kJ. C2H5COOC(CH3)3(CH3)2C=CH2 +...
1)The activation energy for the gas phase
decomposition of t-butyl propionate is
164 kJ.
C2H5COOC(CH3)3(CH3)2C=CH2
+ C2H5COOH
The rate constant at 536 K is
6.91×10-4 /s. The rate constant will be
4.12×10-3 /s at K.
2)The activation energy for the gas phase
decomposition of t-butyl propionate is
164 kJ.
C2H5COOC(CH3)3(CH3)2C=CH2
+ C2H5COOH
The rate constant at 540 K is
9.02×10-4 /s. The rate constant will
be /s at 584 K.
3) For the gas phase decomposition of
t-butyl propionate,
C2H5COOC(CH3)3(CH3)2C=CH2
+ C2H5COOH...
Consider the bromination of 1-pentanol by HBr to form 1-bromopentane. CH3(CH2)3CH2OH + HBr ---> CH3(CH2)3CH2Br +...
Consider the bromination of 1-pentanol by HBr to form
1-bromopentane.
CH3(CH2)3CH2OH + HBr ---> CH3(CH2)3CH2Br + H2O
1 pentanol mol. weight 88 g/mol
hydrobromic acid 80.9 g/mol
1-bromopentane 151 g/mol
nitric acid 63 g/mol
a) If you had 44 g of 1-pentanol, 34 g of HBr and 1.7 g of
nitric acid, what would be the limiting reagent in this
reaction?
b) What is the theoretical yield of 1-bromopentane in (a) ?
c) If you obtained 16.0 g of 1-bromopentane,...
for the gas phase isomerization of dimethyl maleate, the rate constant in s-1 has been determined...
for the gas phase isomerization of dimethyl maleate,
the rate constant in s-1 has been determined at
several temperatures. when ln k is plotted against the reciprocal
of the Kelvin temperature, the resulting linear plot has a slope of
-1.34 x 104 K and a y-intercept of 11.8. The value of
the rate constant for the gas phase isomerization of dimethyl
maleate at 683 K is _ s-1
enter your answer to one significant figure
The gas phase decomposition of hydrogen iodide to hydrogen gas and iodine gas occurs with a...
The
gas phase decomposition of hydrogen iodide to hydrogen gas and
iodine gas occurs with a rate of 2.35x10^-7 M^-1s^-1 at 283 degree
C and 1.62x10^-3 M^-1s^-1 at 427 degree C.
A. What is the activation energy of this reaction in
kJ/mole?
B. What is the temperature in Celsius of a reaction that has a
rate constant of 2.91x10^-4 M^-1s^-1?
Rate constants for the gas-phase decomposition of hydrogen iodide, 2 HI(g) → H2 (g) + I2...
Rate constants for the gas-phase decomposition of hydrogen
iodide, 2 HI(g) → H2 (g) + I2 (g), are listed in the following
table:
Temperature (Celcius) k(M-1s-1)
283 3.52*10-7
356 3.02*10-5
393 2.19*10-4
427 1.16*10-3
508 3.95*10-2
(a) Find the activation energy (in kJ/mol) using all five data
points. (b) Calculate Ea from the rate constants at 283 °C and 508
°C. (c) Given the rate constant at 283 °C and the value of Ea
obtained in part (b), what is...
The decomposition of XY is second order in XYand has a rate constant of 7.20
The decomposition of XY is second order in XYand has a rate
constant of 7.20
In zero reaction, the decomposition of ammonia gas on a tungsten surface has a rate of...
In zero reaction, the decomposition of ammonia gas on a
tungsten surface has a rate of 22.3 x10-4 moles liter-1 minute-1 at
1100 K when the concentration of the NH3 = 0.01M
a. Why doubling the concentration of the ammonia has no effect
on the rate of the reaction. Why this happens.
c. What is the concentration of the ammonia after 30 minutes
have elapsed?
d. How long will it take for the concentration of the ammonia
to drop to...
The gas phase reaction 2A + B →2C is carried out isothermally and isobarically. The reaction ...
The gas phase
reaction
2A + B →2C
is
carried out isothermally
and isobarically. The
reaction is first
order in A
and first order in B. The feed is equal molar in
A and B and the entering concentration of A is 0.5 mol/dm3. The
specific reaction rate is k = 4.0 dm3/mol s.
Write
the rate of
reaction, –rA,
solely as a
function of conversion,
evaluating all parameters.
The gas phase reaction 2A + B →2C is carried out isothermally and isobarically. The reaction ...
The gas phase
reaction
2A + B →2C
is
carried out isothermally
and isobarically. The
reaction is first
order in A
and first order in B. The feed is equal molar in
A and B and the entering concentration of A is 0.5 mol/dm3. The
specific reaction rate is k = 4.0 dm3/mol s.
Write
the rate of
reaction, –rA,
solely as a
function of conversion,
evaluating all parameters.
The gas phase reaction H2 + I2 --> 2HI is second order. Its rate constant at...
The gas phase reaction H2 + I2 --> 2HI is second order. Its
rate constant at 400 C is 0.0243 dm3/mol s. Calculate delta H,
delta S, delta G and the pre-exponential at this temperature.
Assume that delta H is constant over this temperature range.
ADVERTISEMENT
ADVERTISEMENT
Latest Questions
- Use the bond term's below to answer the question Maturity 7 years Coupon Rate 4% Face...
- What experience have you had with Organization Development or with Change Management? Describe the organization, the...
- 1. Renfro Rentals has issued bonds that have a 12% coupon rate, payable semiannually. The bonds...
- Given an array of positive integers a, your task is to calculate the sum of every...
- Define “culture.” Software is defined by the Merriam-Webster Dictionary as "the programs that run on a...
- In humans, hypotrichosis (sparse body hair) is a rare autosomal recessive condition. Let h = hypotrichosis...
- Increase all of the listing prices by 5% for all listings under $500,000 and 10% for...
ADVERTISEMENT