Question

In: Chemistry

The Ka of benzoic acid (C6H5COOH) is 6.45 x 10-5 . Sodium benzoate (NaC6H5COO) is a...

The Ka of benzoic acid (C6H5COOH) is 6.45 x 10-5 . Sodium benzoate (NaC6H5COO) is a common food preservative. If you dissolve 0.100 grams of sodium benzoate into 100.0 mL of water, what will be the pH of this solution?

Solutions

Expert Solution

C6H5COO- + H2O <------> C6H5COOH + OH-

Kb = [C6H5COOH][OH-]/[C6H5COO-][H2O]

Kb = Kw/Ka

Kw = 1×10^-14

Ka = 6.45×10^-5

Kb = 1×10^-14/6.45 × 10^-5

Kb = 1.55 × 10^-10

Kb = [C6H5COOH][OH-]/[C6H5COO-]

at equilibrium

[C6H5COOH] = X

[OH-] = X

Initial concentration of C6H5COONa

Molar mass of C6H5COONa = 144.10g/mole

Mass of C6H5COONa = 0.100g

No of mole = 0.100/144.10= 0.000694 mole

initialConcentration of C6H5COONa = ( 0.000694mole/100ml)×1000ml = 0.00694M

Therefore, [C6H5COO-] at equilibrium = 0.00694- X

1.55×10^-10 = X^2/(0.00694-X)

(0.010757 × 10^-10)- 1.55×10^-10X = X^2

X^2 + (1.55 × 10 ^-10 X) -(0.010757 ×10^-10) = 0

X= 1.037× 10^-6

[C6H5COOH ] = 1.037 ×10^-6M

[OH] = 1.037 ×10^-6M

[C6H5COO-] = 0.00694 - 1.037× 10^-6 = 0.00694M

[OH-] = 1.037 × 10^-6 M

pOH = -log[OH-]

pOH = - log (1.037 × 10^-6)

= 5.98

pH + pOH = 14

pH = 14- 5.98 = 8.02

Therefore, pH of the C6H5COONa solution = 8.02


Related Solutions

Calculate the pH in 0.050 M sodium benzoate; Ka for benzoic acid (C6H5CO2H) is 6.5×10−5.
Calculate the pH in 0.050 M sodium benzoate; Ka for benzoic acid (C6H5CO2H) is 6.5×10−5.
Calculate the percent dissociation of 0.40 M benzoic acid, C6H5COOH. (Ka = 6.3 x 10^-5) ___%?
Calculate the percent dissociation of 0.40 M benzoic acid, C6H5COOH. (Ka = 6.3 x 10^-5) ___%?
25.0 mL of a 0.500 M solution of benzoic acid (C6H5COOH, Ka = 6.5 × 10-5)...
25.0 mL of a 0.500 M solution of benzoic acid (C6H5COOH, Ka = 6.5 × 10-5) is treated with 25.0 mL of a 0.400 M solution of KOH. Determine the pH of the solution. A. 4.79    B. 4.29    C. 4.09       D. 3.59
Titrate 40.0 mL of 0.0350 M benzoic acid (C6H5COOH, Ka = 6.3 × 10–5) with 0.0700...
Titrate 40.0 mL of 0.0350 M benzoic acid (C6H5COOH, Ka = 6.3 × 10–5) with 0.0700 M NaOH Calculate the pH in the solution after addition of 25.0 mL of 0.0700 M NaOH. a) 2.269 b) 8.284 c) 9.845 d) 11.731 e) 5.628
The Ka of benzoic acid is 6.5 x 10 ^(-5) a) Calculate the pH of a...
The Ka of benzoic acid is 6.5 x 10 ^(-5) a) Calculate the pH of a 40.00 mL, 0.1 M benzoic acid buffer solution after the addition of 20.00 mL of a 0.1M NaOH b) Calculate the pH of a 40.00 mL, 0.1 M benzoic acid buffer solution after the addition of 50.00 mL of a 0.1M NaOH REDOX TITRATION 2) Express the reactions for potassium permanganate titration with sodium oxalate: Hint: include the 2 half-reactions. 3) What is the...
The equilibrium constant (Ka) for benzoic acid is 6.46 x 10^-5. Calculate the ratio of benzoic...
The equilibrium constant (Ka) for benzoic acid is 6.46 x 10^-5. Calculate the ratio of benzoic acid to benzoate ion in solution pH=2.00. Then calculate the same ratio at pH=4.00.
Benzoic acid is a weak acid that has antimicrobial properties. Its sodium salt, sodium benzoate, is...
Benzoic acid is a weak acid that has antimicrobial properties. Its sodium salt, sodium benzoate, is a preservative found in foods, medications, and personal hygiene products. Benzoic acid ionizes in water: C6H5COOH⇌C6H5COO−+H+ The pKa of this reaction is 4.2. In a 0.57 M solution of benzoic acid, what percentage of the molecules are ionized? Express your answer to two significant figures and include the appropriate units.
What should the molar concentrations of benzoic acid and sodium benzoate be in a solution that...
What should the molar concentrations of benzoic acid and sodium benzoate be in a solution that is buffered at a pH of 4.58 and has a freezing point of -2.0 ∘C? (Assume complete dissociation of sodium benzoate and a density of 1.01 g/mL for the solution.)
What should the molar concentrations of benzoic acid and sodium benzoate be in a solution that...
What should the molar concentrations of benzoic acid and sodium benzoate be in a solution that is buffered at a pH of 4.78 and has a freezing point of -2.0 ∘C? (Assume complete dissociation of sodium benzoate and a density of 1.01 g/mL for the solution.)
What should the molar concentrations of benzoic acid and sodium benzoate be in a solution that...
What should the molar concentrations of benzoic acid and sodium benzoate be in a solution that is buffered at a pH of 4.78 and has a freezing point of -2.0 ∘C? (Assume complete dissociation of sodium benzoate and a density of 1.01 g/mL for the solution.) Express your answers using two significant figures separated by a comma. answer is not 0.11 and 0.44 answer is not 0.11 and 0.45 answer is not 0.11 and 0.46 Textbook says Tf is 1.86...
ADVERTISEMENT
ADVERTISEMENT
ADVERTISEMENT