Question

In: Chemistry

What change in pH should be observed if 10.0 mL of 0.100 M NaOH is added...

What change in pH should be observed if 10.0 mL of 0.100 M NaOH is added to 100 mL of a buffer that is 0.100 M in CH3COOH and 0.100 M in NaCH3CO2? Ka for acetic acid is 1.8 x 10-5.

If you can explain step by step that would be awesome!

Solutions

Expert Solution

CH3COOH +H2O ----->CH3COO- + H3O+

0.1              0                0.1            0    initial

0.1-x                             0.1+x       +x    equlibirium

Ka= [CH3COO-][H3O+]/[CH3COOH]

1.8x10^-5= [0.1+x ][x] /[0.1-x] x=too small so ignored

x= 1.8x10^-5 x0.1 / 0.1

pH= -log 1.8x10^-5= 5-0.255 = 4.745

after adding NaOH

OH- + CH3COOH --->H2O + CH3COO-

0.001mol   0.01mol                0.01mol initial

0                 0.01-.001         0.01+0.001 at eq

Ka= [CH3COO-][H] /[CH3COOH]

1.8x10^-5 = [x][ 0.011] /[0.009] =1.222x

x=1.8x10^-5/ 1.222=1.47x10^-5

pH=-log 1.47x10^-5=5-0.167=4.883

change in pH =4.883- 4.745 = 0.088


Related Solutions

What will be the pH change when 20.0 mL of 0.100 M NaOH is added to...
What will be the pH change when 20.0 mL of 0.100 M NaOH is added to 80.0 mL of a buffer solution consisting of 0.169 M NH3 and 0.188 M NH4Cl? (Assume that there is no change in total volume when the two solutions mix.) pKa = 9.25
What is the change in pH when 10.0 mL of 0.250 M KOH (aq) is added...
What is the change in pH when 10.0 mL of 0.250 M KOH (aq) is added to 100.0 mL of a buffer that is 0.150 M in HCOOH (aq) and 0.100 M in HCOO– (aq)? pKa = 3.75 for HCOOH (aq). Select one: a. –0.26 pH unit b. +0.18 pH unit c. +0.00 pH unit d. –0.81 pH unit QUESTION 2 What is the molarity of an aqueous barium hydroxide solution if it takes 59.9 mL of 0.100 M HCl...
1. What is the change in pH when 10.0 mL of 0.010 M HCl is added...
1. What is the change in pH when 10.0 mL of 0.010 M HCl is added to 500 mL of pure water. 2. What is the change in pH when 10.0 mL of 0.010 M NaOH is added to 500 mL of pure water.
What is the pH change when 22.4 mL of .07 M NaOH is added to 63.6...
What is the pH change when 22.4 mL of .07 M NaOH is added to 63.6 mL of a buffer solution consisting of .124 M NH3 and 0.153 M NH4Cl? (Ka for ammonium ion is 5.6x10^-10.)
What is the pH change when 22.4 mL of .07 M NaOH is added to 63.6...
What is the pH change when 22.4 mL of .07 M NaOH is added to 63.6 mL of a buffer solution consisting of .124 M NH3 and 0.153 M NH4Cl? (Ka for ammonium ion is 5.6x10^-10.)
a) Calculate the change in pH when 5.00 mL of 0.100 M HCl(aq) is added to...
a) Calculate the change in pH when 5.00 mL of 0.100 M HCl(aq) is added to 100.0 mL of a buffer solution that is 0.100 M in NH3(aq) and 0.100 M in NH4Cl(aq). b) Calculate the change in pH when 5.00 mL of 0.100 M NaOH(aq) is added to the original buffer solution.
Calculate the pH change when 10. mL of 3.0 M NaOH is added to 500. mL...
Calculate the pH change when 10. mL of 3.0 M NaOH is added to 500. mL of the following: (a) pure water (b) 0.10 M CH3COO- (c)0.10 M CH3COOH (d)a solution that is 0.10 M CH3COO- and 0.10 M CH3COOH
Calculate the pH change that results when 11 mL of 5.8 M NaOH is added to...
Calculate the pH change that results when 11 mL of 5.8 M NaOH is added to 776 mL of each the following solutions. (See the appendix.) pKa = 9.25 Ka = 5.6e-10 (c) 0.10 M NH3
What is the pH of a solution obtained by adding 50.0 mL of 0.100 M NaOH...
What is the pH of a solution obtained by adding 50.0 mL of 0.100 M NaOH (aq) to 60.0 mL of 0.100 M HCl (aq)? Select one: a. 11.96 b. 2.04 c. 3.11 d. 7.00 QUESTION 2 What is the pH of a solution prepared by dissolving 5.86 grams of propanoic acid, CH3CH2COOH (l), and 1.37 grams of NaOH (s) in enough water to make exactly 250.0 mL of solution. pKa = 4.87 for propanoic acid? Select one: a. 4.58...
Calculate the change in pH when 4.00 mL of 0.100 M HCl(aq) is added to 100.0...
Calculate the change in pH when 4.00 mL of 0.100 M HCl(aq) is added to 100.0 mL of a buffer solution that is 0.100 M in NH3(aq) and 0.100 M in NH4Cl(aq). Delta pH= ? Calculate the change in pH when 4.00 mL of 0.100 M NaOH(aq) is added to the original buffer solution. Delta pH= ?
ADVERTISEMENT
ADVERTISEMENT
ADVERTISEMENT