Question

In: Chemistry

You titrate 50.0 mL of 0.100 M benzoic acid (C6H5COOH) with 0.250 M KOH. What is...

You titrate 50.0 mL of 0.100 M benzoic acid (C6H5COOH) with 0.250 M KOH. What is the pH of the final solution at the equivalence point? Ka of C6H5COOH = 6.3 x 10-5.

If all work could be shown I would appreciate it! I'm super confused.

Solutions

Expert Solution

find the volume of KOH used to reach equivalence point
M(C6H5COOH)*V(C6H5COOH) =M(KOH)*V(KOH)
0.1 M *50.0 mL = 0.25M *V(KOH)
V(KOH) = 20 mL
Given:
M(C6H5COOH) = 0.1 M
V(C6H5COOH) = 50 mL
M(KOH) = 0.25 M
V(KOH) = 20 mL


mol(C6H5COOH) = M(C6H5COOH) * V(C6H5COOH)
mol(C6H5COOH) = 0.1 M * 50 mL = 5 mmol

mol(KOH) = M(KOH) * V(KOH)
mol(KOH) = 0.25 M * 20 mL = 5 mmol


We have:
mol(C6H5COOH) = 5 mmol
mol(KOH) = 5 mmol

5 mmol of both will react to form C6H5COO- and H2O

C6H5COO- here is strong base
C6H5COO- formed = 5 mmol
Volume of Solution = 50 + 20 = 70 mL
Kb of C6H5COO- = Kw/Ka = 1*10^-14/6.3*10^-5 = 1.587*10^-10
concentration ofC6H5COO-,c = 5 mmol/70 mL = 0.0714M

C6H5COO- dissociates as

C6H5COO-        + H2O   ----->     C6H5COOH +   OH-
0.0714                        0         0
0.0714-x                      x         x


Kb = [C6H5COOH][OH-]/[C6H5COO-]
Kb = x*x/(c-x)
Assuming x can be ignored as compared to c
So, above expression becomes

Kb = x*x/(c)
so, x = sqrt (Kb*c)
x = sqrt ((1.587*10^-10)*7.143*10^-2) = 3.367*10^-6

since c is much greater than x, our assumption is correct
so, x = 3.367*10^-6 M



[OH-] = x = 3.367*10^-6 M

use:
pOH = -log [OH-]
= -log (3.367*10^-6)
= 5.4727


use:
PH = 14 - pOH
= 14 - 5.4727
= 8.5273
Answer: 8.53


Related Solutions

Sodium hydroxide is used to titrate 50.0 mL of 0.100 M benzoic acid.(Ka6.3 x10-5) What is...
Sodium hydroxide is used to titrate 50.0 mL of 0.100 M benzoic acid.(Ka6.3 x10-5) What is the pH after addition of 10.0mL of 0.200M NaOH?
Titrate 40.0 mL of 0.0350 M benzoic acid (C6H5COOH, Ka = 6.3 × 10–5) with 0.0700...
Titrate 40.0 mL of 0.0350 M benzoic acid (C6H5COOH, Ka = 6.3 × 10–5) with 0.0700 M NaOH Calculate the pH in the solution after addition of 25.0 mL of 0.0700 M NaOH. a) 2.269 b) 8.284 c) 9.845 d) 11.731 e) 5.628
50.0 mL of 0.100 M H2SO3 is titrated with 0.150 M KOH soluion. a) What is...
50.0 mL of 0.100 M H2SO3 is titrated with 0.150 M KOH soluion. a) What is the initial pH of the sulfurous acid? b) How much titrant is needed to reach the equivalence points? What is the pH at each equivalence point? c) What is the pH of the solution after the following points of the titration (with 0.150 M KOH)? (20.0 mL, 33.3 mL, 60.0 mL, 70.0 mL, 100.0 mL, 120.0 mL, 130.0 mL)?
Consider a mixture of 50.0 mL of 0.100 M HCl and 50.0 mL of 0.100 M...
Consider a mixture of 50.0 mL of 0.100 M HCl and 50.0 mL of 0.100 M acetic acid. Acetic acid has a Ka of 1.8 x 10-5. a. Calculate the pH of both solutions before mixing. b. Construct an ICE table representative of this mixture. c. Determine the approximate pH of the solution. d. Determine the percent ionization of the acetic acid in this mixture
Calculate the pH for 300. mL of a 0.850 M solution of the benzoic acid, (C6H5COOH),...
Calculate the pH for 300. mL of a 0.850 M solution of the benzoic acid, (C6H5COOH), Ka=6.30x10-5 ) being titrated with 0.850 M NaOH at the following positions in the titration. a) The initial pH (before any NaOH has been added). a. 1.436 b. 12.864 c. 5.435 d. 8.534 e. 2.136 b) The pH of the solution after 125.0 mL of 0.850 M NaOH has been added. a. 10.034 b. 4.054 c. 3.543 d. 8.534 e. 2.132 c) The pH...
A) A chemist titrates a 25.0 mL sample of 0.191 M benzoic acid (C6H5COOH) against a...
A) A chemist titrates a 25.0 mL sample of 0.191 M benzoic acid (C6H5COOH) against a 0.100 M solution of NaOH. The overall reaction is shown by the equation below: $$C6​H5​COOH(aq)+NaOH(aq) C6​H5​COONa(aq)+H2​O(l) The Ka value for benzoic acid is 6.28 × 10–5. Calculate the pH at the start of the titration, before any NaOH has been added. Give your answer correctly to two places after the decimal. B) What will the pH be when 12.0 mL of 0.100 M NaOH...
For the titration of 50.0 mL of 0.150 M acetic acid with 0.100 M sodium hydroxide,...
For the titration of 50.0 mL of 0.150 M acetic acid with 0.100 M sodium hydroxide, determine the pH when: (a) 50.0 mL of base has been added. (b) 75.0 mL of base has been added. (c) 100.0 mL of base has been added.
Find the pH during the titration of 20.00 mL of 0.1460 M benzoic acid, C6H5COOH (Ka...
Find the pH during the titration of 20.00 mL of 0.1460 M benzoic acid, C6H5COOH (Ka = 6.3 ✕ 10-5), with 0.1460 M NaOH solution after the following additions of titrant. A) 0 mL B) 10.00 mL C) 15.00 mL D) 19.00 mL
25.0 mL of a 0.500 M solution of benzoic acid (C6H5COOH, Ka = 6.5 × 10-5)...
25.0 mL of a 0.500 M solution of benzoic acid (C6H5COOH, Ka = 6.5 × 10-5) is treated with 25.0 mL of a 0.400 M solution of KOH. Determine the pH of the solution. A. 4.79    B. 4.29    C. 4.09       D. 3.59
Find the pH during the titration of 20.00 mL of 0.2850 M benzoic acid, C6H5COOH (Ka...
Find the pH during the titration of 20.00 mL of 0.2850 M benzoic acid, C6H5COOH (Ka = 6.3  10-5), with 0.2850 M NaOH solution after the following additions of titrant. (a) 0 mL (b) 10.00 mL (c) 15.00 mL (d) 20.00 mL (e) 25.00 mL
ADVERTISEMENT
ADVERTISEMENT
ADVERTISEMENT