Question

In: Chemistry

A) A chemist titrates a 25.0 mL sample of 0.191 M benzoic acid (C6H5COOH) against a...

A) A chemist titrates a 25.0 mL sample of 0.191 M benzoic acid (C6H5COOH) against a 0.100 M solution of NaOH. The overall reaction is shown by the equation below: $$C6​H5​COOH(aq)+NaOH(aq) C6​H5​COONa(aq)+H2​O(l) The Ka value for benzoic acid is 6.28 × 10–5. Calculate the pH at the start of the titration, before any NaOH has been added. Give your answer correctly to two places after the decimal.

B) What will the pH be when 12.0 mL of 0.100 M NaOH has been added to the weak acid solution? Give your answer to two places after the decimal.

Solutions

Expert Solution

A)

C6H5COOH dissociates as:

C6H5COOH -----> H+ + C6H5COO-

0.191 0 0

0.191-x x x

Ka = [H+][C6H5COO-]/[C6H5COOH]

Ka = x*x/(c-x)

Assuming x can be ignored as compared to c

So, above expression becomes

Ka = x*x/(c)

so, x = sqrt (Ka*c)

x = sqrt ((6.28*10^-5)*0.191) = 3.463*10^-3

since x is comparable c, our assumption is not correct

we need to solve this using Quadratic equation

Ka = x*x/(c-x)

6.28*10^-5 = x^2/(0.191-x)

1.199*10^-5 - 6.28*10^-5 *x = x^2

x^2 + 6.28*10^-5 *x-1.199*10^-5 = 0

This is quadratic equation (ax^2+bx+c=0)

a = 1

b = 6.28*10^-5

c = -1.199*10^-5

Roots can be found by

x = {-b + sqrt(b^2-4*a*c)}/2a

x = {-b - sqrt(b^2-4*a*c)}/2a

b^2-4*a*c = 4.798*10^-5

roots are :

x = 3.432*10^-3 and x = -3.495*10^-3

since x can't be negative, the possible value of x is

x = 3.432*10^-3

use:

pH = -log [H+]

= -log (3.432*10^-3)

= 2.4644

Answer: 2.46

B)

Given:

M(C6H5COOH) = 0.191 M

V(C6H5COOH) = 25 mL

M(NaOH) = 0.1 M

V(NaOH) = 12 mL

mol(C6H5COOH) = M(C6H5COOH) * V(C6H5COOH)

mol(C6H5COOH) = 0.191 M * 25 mL = 4.775 mmol

mol(NaOH) = M(NaOH) * V(NaOH)

mol(NaOH) = 0.1 M * 12 mL = 1.2 mmol

We have:

mol(C6H5COOH) = 4.775 mmol

mol(NaOH) = 1.2 mmol

1.2 mmol of both will react

excess C6H5COOH remaining = 3.575 mmol

Volume of Solution = 25 + 12 = 37 mL

[C6H5COOH] = 3.575 mmol/37 mL = 0.0966M

[C6H5COO-] = 1.2/37 = 0.0324M

They form acidic buffer

acid is C6H5COOH

conjugate base is C6H5COO-

Ka = 6.28*10^-5

pKa = - log (Ka)

= - log(6.28*10^-5)

= 4.202

use:

pH = pKa + log {[conjugate base]/[acid]}

= 4.202+ log {3.243*10^-2/9.662*10^-2}

= 3.728

Answer: 3.73


Related Solutions

25.0 mL of a 0.500 M solution of benzoic acid (C6H5COOH, Ka = 6.5 × 10-5)...
25.0 mL of a 0.500 M solution of benzoic acid (C6H5COOH, Ka = 6.5 × 10-5) is treated with 25.0 mL of a 0.400 M solution of KOH. Determine the pH of the solution. A. 4.79    B. 4.29    C. 4.09       D. 3.59
A chemist titrates 210.0 mL of a 0.7560 M butanoic acid (HC3H7CO2) solution with 0.6335 M...
A chemist titrates 210.0 mL of a 0.7560 M butanoic acid (HC3H7CO2) solution with 0.6335 M KOH solution at 25 degrees celsius. Calculate the pH at equivalence. The pKa of butanoic acid is 4.82. Round your answer to 2 decimal places please
Calculate the pH for 300. mL of a 0.850 M solution of the benzoic acid, (C6H5COOH),...
Calculate the pH for 300. mL of a 0.850 M solution of the benzoic acid, (C6H5COOH), Ka=6.30x10-5 ) being titrated with 0.850 M NaOH at the following positions in the titration. a) The initial pH (before any NaOH has been added). a. 1.436 b. 12.864 c. 5.435 d. 8.534 e. 2.136 b) The pH of the solution after 125.0 mL of 0.850 M NaOH has been added. a. 10.034 b. 4.054 c. 3.543 d. 8.534 e. 2.132 c) The pH...
You titrate 50.0 mL of 0.100 M benzoic acid (C6H5COOH) with 0.250 M KOH. What is...
You titrate 50.0 mL of 0.100 M benzoic acid (C6H5COOH) with 0.250 M KOH. What is the pH of the final solution at the equivalence point? Ka of C6H5COOH = 6.3 x 10-5. If all work could be shown I would appreciate it! I'm super confused.
Find the pH during the titration of 20.00 mL of 0.1460 M benzoic acid, C6H5COOH (Ka...
Find the pH during the titration of 20.00 mL of 0.1460 M benzoic acid, C6H5COOH (Ka = 6.3 ✕ 10-5), with 0.1460 M NaOH solution after the following additions of titrant. A) 0 mL B) 10.00 mL C) 15.00 mL D) 19.00 mL
Find the pH during the titration of 20.00 mL of 0.2850 M benzoic acid, C6H5COOH (Ka...
Find the pH during the titration of 20.00 mL of 0.2850 M benzoic acid, C6H5COOH (Ka = 6.3  10-5), with 0.2850 M NaOH solution after the following additions of titrant. (a) 0 mL (b) 10.00 mL (c) 15.00 mL (d) 20.00 mL (e) 25.00 mL
Find the pH during the titration of 20.00 mL of 0.2290 M benzoic acid, C6H5COOH (Ka...
Find the pH during the titration of 20.00 mL of 0.2290 M benzoic acid, C6H5COOH (Ka = 6.3 ✕ 10-5), with 0.2290 M NaOH solution after the following additions of titrant. (a)    0 mL = (b)    10.00 mL = (c)    15.00 mL = (d)    19.00 mL = (e)    19.95 mL = (f)    20.00 mL = (g)    20.05 mL = (h)    25.00 mL = Please help..!!! xoxo
Find the pH during the titration of 20.00 mL of 0.2830 M benzoic acid, C6H5COOH (Ka...
Find the pH during the titration of 20.00 mL of 0.2830 M benzoic acid, C6H5COOH (Ka = 6.3 ✕ 10-5), with 0.2830 M NaOH solution after the following additions of titrant. (a)    0 mL (b)    10.00 mL (c)    15.00 mL (d)    19.00 mL (e)    19.95 mL (f)    20.00 mL (g)    20.05 mL (h)    25.00 mL
Find the pH during the titration of 20.00 mL of 0.1500 M benzoic acid, C6H5COOH (Ka...
Find the pH during the titration of 20.00 mL of 0.1500 M benzoic acid, C6H5COOH (Ka = 6.3 10-5), with 0.1500 M NaOH solution after the following additions of titrant. (a) 0 mL (b) 10.00 mL (c) 15.00 mL (d) 20.00 mL (e) 25.00 mL
Find the pH during the titration of 20.00 mL of 0.1630 M benzoic acid, C6H5COOH (Ka...
Find the pH during the titration of 20.00 mL of 0.1630 M benzoic acid, C6H5COOH (Ka = 6.3 ? 10-5), with 0.1630 M NaOH solution after the following additions of titrant. (a)    0 ml (b)    10.00 mL (c)    15.00 mL (d)    19.00 mL (e)    19.95 mL (f)    20.00 mL (g)    20.05 mL (h)    25.00 mL
ADVERTISEMENT
ADVERTISEMENT
ADVERTISEMENT