Question

In: Chemistry

1- How IMAF's would work to dissolve something? 2- give me one IMAF example

1- How IMAF's would work to dissolve something?

2- give me one IMAF example

Expert Solution

The intermolecular force is very important for solubility

The stronger the intermolecular forces between solute

molecule and solvent molecule, the greater the solubility of the solute in the solvent.

• Polar molecules are soluble in polar solvents (Predominant intermolecular force is

dipole-dipole attraction between polar solute molecule and polar solvent molecule).

• Nonpolar molecules are soluble in nonpolar solvents (Predominant intermolecular

force is London dispersion attraction between nonpolar solute molecule and

nonpolar solvent molecule).

• Polar molecules and nonpolar molecules do not mix.

Trends

1. Between two polar molecules, the molecule with the smaller hydrocarbon portion

(or the larger polar portion) is more soluble in water.

CH3CH2OH Soluble in water

CH3CH3CH3CH3CH3CH2OH Insoluble in water

CH2(OH)CH(OH)CH(OH)CH(OH)CH(OH)CH2OH Soluble in water. Large but many OHs

that can hydrogen bond with water.

2. If completely nonpolar, insoluble in water (and soluble in nonpolar solvents).

CH3CH3CH3CH3CH3CH3 Insoluble in water

queen_honey_blossom answered 9 months ago

Can you please give me 1 example on how would the variable expenses increase as a...

Can you please give me 1 example on how would the variable expenses increase as a percentage of the selling price ?

Give me an example of a foreseeable and an unforeseeable consequence to changing work to a...

Give me an example of a foreseeable and an unforeseeable consequence to changing work to a primarily "Work from home" operation

Compare and contrast GDP and GNP. Give an example of something that would be counted in...

Compare and contrast GDP and GNP. Give an example of something that would be counted in U.S. GDP but not in U.S. GNP. Then give an example of something that would be counted in U.S. GNP but not in U.S. GDP.

Describe how catalysts work and give an example of one. What is the Kd for a...

Describe how catalysts work and give an example of one. What is the Kd for a catalyst and how would you interpret a low Kd. How do non-specific DNA binding proteins work? How do specific DNA binding proteins work?

Give one example how the the endocrine system work with the immune system?

Heuristics are mental shortcuts. Select one and give me an example of how you use it...

Heuristics are mental shortcuts. Select one and give me an example of how you use it when you shop.

Can someone give me an example of 2 companies from the same industry a BIG one...

Can someone give me an example of 2 companies from the same industry a BIG one and a SMALL one and compare the contrast how are they different and the impact of globalization on small and big companies .Thank you

(1) Give me an example on how resource scarcity can make effective teams important (2) Trying...

(1) Give me an example on how resource scarcity can make effective teams important (2) Trying to make decisions based on consensus is a very popular method in many meetings. Tell me, in your own words, why you think this method is so prevalent. Also tell me what the downsides are to using consensus?

Give me an example of invitation to offer

1) a) Give short code example of parallel arrays. b) Explain how parallel arrays work. 2)...

1) a) Give short code example of parallel arrays. b) Explain how parallel arrays work. 2) a) How would you compare two arrays to check if they have the same values? b) Assume array1 and array2 are int arrays with 10 elements in each. if(array1 == array2) What is this comparing? 3 a) Can you encounter memory violation using an array? b) If yes explain. If no, explain why not.