Question

In: Chemistry

Isoamyl acetate is the primary component of artificial banana flavor. Which signals will be in the...

Isoamyl acetate is the primary component of artificial banana flavor. Which signals will be in the positive phase, negative phase, or nonexistent in normal 13C NMRof isoamyl acetate?

Solutions

Expert Solution

Ans.

The structure of isoamyl acetate is shown below.

In a proton decoupled C13 NMR, there will be six signals due to six Cs in different chemical environment.

In DEPT 45, signals for carbons in CH, CH2 and CH3 will be positive. So, there will be five signals and there will be no signal for carbon numbered (e).

DEPT 90 shows positive signal only for CH groups. So, in DEPT 90 only carbon numbered (b) will show a positive signal. Other carbons will not show any signal in DEPT 90.

DEPT 135 shows positive signal for CH and CH3 groups and negative signal for CH2 group. So in DEPT 135, carbons numbered (a), (b) and (f) will show a positive signal. Carbons numbered (c) and (d) will show negative signal. Carbon numbered (e) will not show any peak in DEPT 135.


Related Solutions

Fischer Esterification: Synthesis of Isoamyl Acetate (Banana Oil) 4) a) What is the role of sulfuric...
Fischer Esterification: Synthesis of Isoamyl Acetate (Banana Oil) 4) a) What is the role of sulfuric acid in the reaction? b) Why is the mixture extracted with sodium bicarbonate? Your answer should include a chemical equation to explain why gas bubbles are observed and identify the gas. c) What is brine and why is it used?
A chemist isolated 0.7886 g of isoamyl acetate from a reaction of 0.8235 g of isoamyl...
A chemist isolated 0.7886 g of isoamyl acetate from a reaction of 0.8235 g of isoamyl alcohol and 1.5 mL of acetic acid. What is the percent yield for the reaction above?
What are the IR and NMR spectral features of isoamyl acetate?
What are the IR and NMR spectral features of isoamyl acetate?
Why should sodium bicarbonate solution be added slowly when synthesizing isoamyl acetate from isoamyl alcohol and...
Why should sodium bicarbonate solution be added slowly when synthesizing isoamyl acetate from isoamyl alcohol and glacial acetic acid? Write balanced equations for all reactions that take place during the neutralization (experiment involves isoamyl alcohol, glacial acetic acid, concentrated sulfuric acid, and 5% aqueous sodium bicarbonate).
Which functional group is not found in gingerol, the flavor component in fresh ginger? Aldehyde, ketone,...
Which functional group is not found in gingerol, the flavor component in fresh ginger? Aldehyde, ketone, ether, alcohol, or aromatic ring?
Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such...
Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A) Given 7.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate...
You have 0.4mL of acetic acid and 0.4mL of isoamyl alcohol for the experiment. Which is...
You have 0.4mL of acetic acid and 0.4mL of isoamyl alcohol for the experiment. Which is the limiting reactant?
Identify the signals used in broadcasting TV studio? Discuss about the signals which are combined in...
Identify the signals used in broadcasting TV studio? Discuss about the signals which are combined in fewer parts for transmitting channels in TV broadcasting.
Explain the parts of a control loop include how components, signals from each component, types of...
Explain the parts of a control loop include how components, signals from each component, types of loops such as location, what they measure, and modes of loops.
What is Artificial intelligence (AI)? What is the primary goalof AI? How AI is related...
What is Artificial intelligence (AI)? What is the primary goal of AI? How AI is related to Expert Systems?
ADVERTISEMENT
ADVERTISEMENT
ADVERTISEMENT