The pH of a 0.17-M solution of maleic acid (H2C4H2O4) is measured to be 1.40. Use...

The pH of a 0.17-M solution of maleic acid (H₂C₄H₂O₄) is measured to be 1.40. Use this information to determine a value of K_a for maleic acid.

H₂C₄H₂O₄(aq) + H₂O(l) ((double arrow)) HC₄H₂O₄^-(aq) + H₃O⁺(aq) K_a =

Solutions

Expert Solution

pH = 1.40

use:

pH = -log [H3O+]

1.40 = -log [H3O+]

[H3O+] = 0.0398 M

H2C4H2O4(aq) + H2O(l) —> HC4H2O4-(aq) + H3O+(aq)

0.17 0 0 (initial)

0.17-x x x (at equilibrium)

here,

[H3O+] = x = 0.0398 M

Ka = [HC4H2O4-][H3O+]/[H2C4H2O4]

Ka = x*x / (0.17-x)

Ka = 0.0398* 0.0398 / (0.17-0.0398)

Ka = 0.012

Answer: 0.012

queen_honey_blossom answered 1 year ago

Next > < Previous

Related Solutions

Calculate the pH of each solution. A. A solution containing 0.0133 M maleic acid and 0.0189...

Calculate the pH of each solution. A. A solution containing 0.0133 M maleic acid and 0.0189 M disodium maleate. The Ka values for maleic acid are 1.20×10−2 (Ka1) and 5.37×10−7 (Ka2). B. A solution containing 0.0368 M succinic acid and 0.022 M potassium hydrogen succinate. The Ka values for succinic acid are 6.21×10−5 (Ka1) and 2.31×10−6 (Ka2).

Calculate pH for the following situations: a) A solution containing 0.0357 M maleic acid and 0.051...

Calculate pH for the following situations: a) A solution containing 0.0357 M maleic acid and 0.051 M disodium maleate. The Ka values for maleic acid are 1.20 × 10-2 (Ka1) and 5.37 × 10-7 (Ka2). b) A solution containing 0.0295 M succinic acid and 0.016 M potassium hydrogen succinate. The Ka values for succinic acid are 6.21 × 10-5 (Ka1) and 2.31 × 10-6 (Ka2).

Calculate the pH of 0.305 L of a 0.17 M acetic acid - 0.28 M sodium...

Calculate the pH of 0.305 L of a 0.17 M acetic acid - 0.28 M sodium acetate buffer before (pH1) and after (pH2) the addition of 0.0062 mol of HBr. Assume that the volume remains constant. (Ka of acetic acid is 1.8⋅10−5) Express your answers using three significant figures separated by commas.

1) calculate the concentration of maleic acid solution?given : 25.00 mL of maleic acid of unknown...

1) calculate the concentration of maleic acid solution?given : 25.00 mL of maleic acid of unknown contration is diluted with 50.00 mL of water. It is used to titrate 49.72mL of 0.1 M NaOH solution. 2)calculate the concentration of the diluted and undiluted CH3COOH (aq) solution. given: 25.00 mL of unknown acetic acid solution is diluted with 50.00 mL water. It is used to titrate 49.83 mL of 0.1 M NaOH solution

1. Calculate the pH of a 0.17 M solution of HClO, with K_a = 3.5x10^{−8}. 2....

1. Calculate the pH of a 0.17 M solution of HClO, with K_a = 3.5x10^{−8}. 2. At 25°C, 2.29E0 grams of sodium hydroxide is dissolved in enough water to make 500. mL of solution. Calculate [H_3O^+]. Do not enter units as part of your answer.

A) If a 10.0 mL solution of "acid rain" is measured to have a pH of...

A) If a 10.0 mL solution of "acid rain" is measured to have a pH of 2.75, what is the molar concentration of strong acid HNO3 formed? Hint: pH=-log[H+] and 10^-pH=[H+] is in molarity units. B) The total acid concentration (nitric + nitrous acid) of the 10.0 mL solution of "acid rain" is determined by an acid-base titration method. You add 5.00 mL of the titrant sodium hydroxide with a concentration of 0.0114 M to reach the endpoint. i. What...

Use a mathematical solution to determine the pH of a solution containing 10-2 M propionic acid...

Use a mathematical solution to determine the pH of a solution containing 10-2 M propionic acid (C₂H₅COOH; pKa = 4.88).

The pH of a 0.77M solution of boric acid H3BO3 is measured to be 4.68. Calculate...

The pH of a 0.77M solution of boric acid H3BO3 is measured to be 4.68. Calculate the acid dissociation constant Ka of boric acid. Be sure your answer has the correct number of significant digits.

The pH of an aqueous solution of 0.441 M acetic acid is _______________

consider a 1.00 M solution of a weak acid, HA. The pH of the solution is...

consider a 1.00 M solution of a weak acid, HA. The pH of the solution is found to be 3.85. A) calculate the [H3O+] in the solution. This would be the equilibrium concentration of H3O+ in the solution. B) write out an ICE table as before. Here, we don’t know the numerical value of Ka but we know the [H3O+] at equilibrium which you should see from your ICE table easily relates to the value of “x” in your table...

Subjects