Question

In: Chemistry

What is the pH at the equivalence point for the titration of 25.00 mL 0.100 M...

What is the pH at the equivalence point for the titration of 25.00 mL 0.100 M CH3CH2CH2CO2- with 0.1848 M HCl? Species (K values) CH3CH2CH2CO2H (Ka = 1.14E-5) CH3CH2CH2CO2- (Kb = 2.63x10-10

Solutions

Expert Solution

The acid-base neutralization reaction is given as

CH3CH2CH2CO2- (aq) + HCl (aq) --------> CH3CH2CH2COOH (aq) + Cl- (aq)

As per the stoichiometric equation,

1 mole CH3CH2CH2CO2- = 1 mole HCl = 1 mole CH3CH2CH2COOH

Millimoles of CH3CH2CH2CO2- = (25.00 mL)*(0.100 M) = 2.500 mmole = millimoles of HCl required to reach the equivalence point = millimoles of CH3CH2CH2CO2H formed at the equivalence point.

Milliliters of HCl required to reach the equivalence point = (2.500 mmole)/(0.1848 M) = 13.5281 mL ≈ 13.53 mL.

Total volume of the solution at the equivalence point is (25.00 + 13.53) mL = 38.53 mL and the concentration of CH3CH2CH2COOH is (2.50 mmole)/(38.53 mL) = 0.064884 M ≈ 0.065 M.

At the equivalence point, we have only CH3CH2CH2CO2H which is a weak acid and undergoes dissociation as

CH3CH2CH2CO2H (aq) --------> CH3CH2CH2CO2- (aq) + H+ (aq)

Ka = [CH3CH2CH2CO2-][H+]/[CH2CH2CH2CO2H]

=====> 1.14*10-5 = (x).(x)/(0.065 – x)

Since [CH3CH2CH2CO2H] is low and Ka is low, we can assume x << 0.065 M and hence,

1.14*10-5 = x2/(0.065)

====> x2 = 7.41*10-7

====> x = 8.608*10-4

Therefore, [H+] = 8.608*10-4 M and pH = -log [H+] = -log (8.608*10-4) = 3.065 (ans).


Related Solutions

What is the pH at the equivalence point of the titration of 50.0 mL of 0.100...
What is the pH at the equivalence point of the titration of 50.0 mL of 0.100 M HN4+ with 50.0 ml of 0.100 M NaOH? (For NH3 Kb = 1.8 x 10−5)
What is the pH at the equivalence point of the titration of 50.0 mL of 0.100...
What is the pH at the equivalence point of the titration of 50.0 mL of 0.100 M HN4+ with 50.0 ml of 0.100 M NaOH? (For NH3 Kb = 1.8 x 10−5)
In the titration of 25.00 mL of 0.100 M acetic acid, what is the pH of...
In the titration of 25.00 mL of 0.100 M acetic acid, what is the pH of the resultant solution after the addition of 15.06 mL of 0.100 M of KOH? Assume that the volumes of the solutions are additive. Ka = 1.8x10-5 for acetic acid, CH3COOH.
In the titration of 25.00 mL of 0.100 M acetic acid, what is the pH of...
In the titration of 25.00 mL of 0.100 M acetic acid, what is the pH of the resultant solution after the addition of 25.00 mL of 0.100 M KOH? Assume that the volumes of the solutions are additive. Ka = 1.8x10-5 for CH3COOH.
Calculate the pH at the equivalence point in the titration of 20.00 mL of a 0.100...
Calculate the pH at the equivalence point in the titration of 20.00 mL of a 0.100 M solution of CH3NH2 (Kb for CH3NH2 = 4.4 × 10-4) with a 0.200 M HCl solution. (The reaction products are CH3NH3+ and Cl-)
Calculate the pH at the equivalence point for the titration of 0.100 M methylamine (CH3NH2) with...
Calculate the pH at the equivalence point for the titration of 0.100 M methylamine (CH3NH2) with 0.100 M HCl. The Kb of methylamine is 5.0
What is the pH at the equivalence point when 25.00 mL of a 0.150 M solution...
What is the pH at the equivalence point when 25.00 mL of a 0.150 M solution of acetic acid (CH3COOH) is titrated with 0.10 M NaOH to its end point?
A) What is the pH at the equivalence point in the titration of a 15.6 mL...
A) What is the pH at the equivalence point in the titration of a 15.6 mL sample of a 0.312 M aqueous hypochlorous acid solution with a 0.302 M aqueous barium hydroxide solution? pH = ___ B) When a 18.2 mL sample of a 0.426 M aqueous hypochlorous acid solution is titrated with a 0.458 M aqueous barium hydroxide solution, what is the pH at the midpoint in the titration? pH = ___
What is the pH at the equivalence point in the titration of of a 29.5 mL...
What is the pH at the equivalence point in the titration of of a 29.5 mL sample of a 0.460 M aqueous hydroflouric acid solution with a 0.358 M aqueous sodium hydroxide solution? pH - ___
Calculate the pH at the equivalence point in the titration of 30.0 mL of 0.135 M...
Calculate the pH at the equivalence point in the titration of 30.0 mL of 0.135 M methylamine (Kb = 4.4 × 10−4) with 0.270 M HCl.
ADVERTISEMENT
ADVERTISEMENT
ADVERTISEMENT