Question

In: Chemistry

A. 100ml of 0.5M acetic avid is titration with 20ml of 0.5M KOH. What is the...


A. 100ml of 0.5M acetic avid is titration with 20ml of 0.5M KOH. What is the pH of the acid before titration? (ka acetic acid is 1.8 x 10^-5)

B. What is the pH of the solution after titration?

Solutions

Expert Solution

Solution :-

A) Acetic acid is the weak acid therefore it do not dissociate 100 %

lets calculate the concnetration of the H3O+ using the Ka

CH3COOH + H2O   ----- > H3O^+   + CH3COO^-

0.5                                     0                0

-x                                       +x               +x

0.5-x                                    x               x

ka = [H3O+][CH3COO-]/[CH3COOH]

1.8*10^-5 = [x][x]/[0.5-x]

since the Ka is very small therefore we can neglect the x from the denominator

then we get

1.8*10^-5 = [x][x]/[0.5]

1.8*10^-5 * 0.5 = x^2

9.0*10^-6 = x^2

taking square root of the both sides we get

3.0*10^-3 = x

now lets calculate the pH

pH= -log [H3O+]

pH= - log [3.0*10^-3]

pH= 2.52

Therefore pH before addition of the KOH is 2.52

B) pH after adding 20.0 ml of 0.5 K KOH

lets first calculate the moles of acetic and KOH

moles = molarity * volume

Moles of acetic acid = 0.5 mol per L * 0.100 L =0.05 mol

moles of KOH = 0.5 mol per L * 0.020 L = 0.01 mol KOH

moles of the KOH are limiting therefore after the reaction 0.01 mol acetic acid is reduced and 0.01 mol acetate ion will be formed

so new moles of acetic acid = 0.05 mol - 0.01 mol = 0.04 mol

moles of acetate ion = 0.01 mol

now lets calculate the new molarities at total volume (100.0 ml + 20.0 ml = 120.0 ml = 0.120 L)

acetic acid = 0.04 mol / 0.120 L = 0.3333 M

acetateion = 0.01 mol / 0.120 L = 0.08333 M

now lets calculate the pH of the solution using the Henderson equation

pH= pka + log ([base]/[acid])

pka = -log ka

pka of acetic acid = - log 1.8*10^-5 = 4.74

lets put the values in the formula

pH= pka + log ([base]/[acid])

pH= 4.74 + log [0.0833 / 0.3333]

pH= 4.74 +(-0.602)

pH= 4.14

Therefore pH after adding the KOH = 4.14


Related Solutions

4. Suppose you have a 20ml solution of 0.5M acetic acid (Ka = 1.8x10-5). What is...
4. Suppose you have a 20ml solution of 0.5M acetic acid (Ka = 1.8x10-5). What is the pH of the solution after adding 10ml of .4M sodium hydroxide? 15mL? 35mL? At the equivalence point? Draw the expected titration curve with equivalence point indicated
4. The following shows titration of hydrocyanic acid(HCN) with potassium hydroxide (KOH). 100ml of 0.02M HCN...
4. The following shows titration of hydrocyanic acid(HCN) with potassium hydroxide (KOH). 100ml of 0.02M HCN was titrated with 0.050M of KOH. (Ka of HCN is 4.9x10-10) HCN(aq) +KOH(aq)----->KCN(aq)+H2O(l) a) How much KOH solution is needed to reach the equilence point? b)Calculate pH at the equivalence point. c)Calculate pH when 15mL of KOH was added. d)Calculate pH when 50mL of KOH was added.
1. shake sorting funnel with 1-butanol 20mL and 0.5N acetic acid aqueous solution 20mL in it.
  1. shake sorting funnel with 1-butanol 20mL and 0.5N acetic acid aqueous solution 20mL in it. 2. When water layer and butanol layer are separated, extract 0.5N acetic acid 10mLto beaker A and add distilled water 10mL 3. Titrate solution in beaker A with 0.5N NaOH aqueous solution. 4. Extract 1-butanol to beaker B and tiltrate with 0.5N NaOH 5. Calculate Distribution coefficient What would be ideal Distribution Coefficient K?
The titrant 0.25M HCl is being used to titrate 20mL of a solution of 100mL water...
The titrant 0.25M HCl is being used to titrate 20mL of a solution of 100mL water and 1.5g Ca(OH)2 and then again to titrate 20mL of a solution of 1.5g Ca(OH)2 and 100mL Ca(NO3)2. WHAT is the reaction between the titrant and what is being titrated? and what information can be gathered from the titration data?
Calculate the pH of a 1L aqueous solution containing: a) 20mL of 4M HCl b) 100mL...
Calculate the pH of a 1L aqueous solution containing: a) 20mL of 4M HCl b) 100mL of 2M NaOH c) 50mL of 100mM acetic acid and 200mL of 150mM potassium acetate (pKa is 4.76) Please show work, thanks!!
pH calculations, pKa of acetic acid = 4.76. A mixture of 100mL of 0.10 M acetic...
pH calculations, pKa of acetic acid = 4.76. A mixture of 100mL of 0.10 M acetic acid with 100mL of 0.05M NaOH
Let's say you are going to titrate a 200 ml solution of 0.5M KOH with a...
Let's say you are going to titrate a 200 ml solution of 0.5M KOH with a 0.1M solution of HNO3. a) What is the initial pH? b) Determine the pH when 300ml, 500ml, 975ml, 1000ml, 1005 ml, and 2000ml of the acid are added to the initial solution. c) Sketch a rough titration curve.
In a titration of 200 ml of 0.150 M HCl with 0.200 M KOH, what is...
In a titration of 200 ml of 0.150 M HCl with 0.200 M KOH, what is the pH after 70.0 ml of KOH have been added?
In the titration of 25.00 mL of 0.100 M acetic acid, what is the pH of...
In the titration of 25.00 mL of 0.100 M acetic acid, what is the pH of the resultant solution after the addition of 15.06 mL of 0.100 M of KOH? Assume that the volumes of the solutions are additive. Ka = 1.8x10-5 for acetic acid, CH3COOH.
In the titration of 25.00 mL of 0.100 M acetic acid, what is the pH of...
In the titration of 25.00 mL of 0.100 M acetic acid, what is the pH of the resultant solution after the addition of 25.00 mL of 0.100 M KOH? Assume that the volumes of the solutions are additive. Ka = 1.8x10-5 for CH3COOH.
ADVERTISEMENT
ADVERTISEMENT
ADVERTISEMENT