Question

In: Computer Science

write a java program to Translate or Encrypt the given string : (input char is all...

write a java program to Translate or Encrypt the given string : (input char is all in capital letters) { 15 }
*) Each character replaced by new character based on its position value in english alphabet. As A is position is 1, and Z is position 26.
*) New characters will be formed after skipping the N (position value MOD 10) char forward. A->A+1= B , B->B+2=D ,C->C+3=F, .... Y->Y+(25%10)->Y+5=D

A B C D E F G H I J K l M N O P Q R S T U V W X Y Z
1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26

Input : AFGKJX
Outout: BLNLJB

Solutions

Expert Solution

import java.util.Scanner;
class Encrypt
{
public static void main(String[] args)
{
    String alphabets="ABCDEFGHIJKLMNOPQRSTUVWXYZ";
    Scanner input=new Scanner(System.in);
    System.out.print("Enter text to encrypt: ");
    String text=input.next();
    String output="";
    int pos;
    //encrypt the given data
    for(int i=0;i<text.length();++i)
    {
      pos=(alphabets.indexOf(text.charAt(i)));
      pos=((pos+1)%26+(pos+1)%10);
      if(pos>26)
      pos=pos-26;
      output=output+alphabets.charAt(pos-1);
    }
System.out.println("Encrypted text: "+output);
}
}

Output


Related Solutions

Write a Java method that takes an array of char and a String as input parameters...
Write a Java method that takes an array of char and a String as input parameters and and returns an boolean. The method returns true if we can find the input string inside the array by starting at any position of the array and reading either forwards or backwards.
how to write program in java for encrypt and decrypt input text using DH algorithm
how to write program in java for encrypt and decrypt input text using DH algorithm
Write a Java program that prompts the user to input a word (String). The program must...
Write a Java program that prompts the user to input a word (String). The program must print the reversed word with all consecutive duplicate characters removed. The program must contain the following classes: - The StackX class (you can use the Java Stack class). - The Reverse class which must contain a private data field called “word” of type string, a constructor, and a void method called revNoDup(). The revNoDup() method must reverse the word and remove the consecutive duplicate...
Write a C program that will read a character string and then encrypt the string based...
Write a C program that will read a character string and then encrypt the string based on one of the 3 different encryption methods. The type of encryption is to be selected by the user. Encryption method 1: Swapping by position. Characters in the array are swapped with the opposite characters based on their position in the string. Example: Input string – apple. Encrypted string – elppa Method: The first character ‘a’ and the last character ‘e’ – swap their...
Write a Java program that prompts the user to input a string and prints whether it...
Write a Java program that prompts the user to input a string and prints whether it is a palindrome. A palindrome is a string which reads the same backward as forward, such as Madam (disregarding punctuation and the distinction between uppercase and lowercase letters). The program must use the stack data structure. The program must include the following classes: The StackX class (or you can use the Java Stack class). The Palindrome class which must contain a method named palindrome()...
Write a JAVA program that reads in a string from standard input and determines the following:...
Write a JAVA program that reads in a string from standard input and determines the following: - How many vowels are in the string (FOR THE PURPOSE OF THIS PROGRAM 'Y' is NOT considered a vowel)? - How many upper case characters are in the string? - How many digits are in the string? - How many white space characters are in the string? - Modify the program to indicate which vowel occurs the most. In the case of a...
Write a C++ Program Write a program that prompts the user to input a string. The...
Write a C++ Program Write a program that prompts the user to input a string. The program then uses the function substr to remove all the vowels from the string. For example, if str=”There”, then after removing all the vowels, str=”Thr”. After removing all the vowels, output the string. Your program must contain a function to remove all the vowels and a function to determine whether a character is a vowel. You must insert the following comments at the beginning...
3. Write a Java program that discover all anagrams of all wordslisted in the input file,...
3. Write a Java program that discover all anagrams of all wordslisted in the input file, “dict.txt”. An anagram of a work is a rearrangement of its letters into a new legal word. Your program should do the following: a. Read in the given “dict.txt” file and sort it in each word’s canonical form. The canonical form of a word contains the same letters as the original word, but in sorted order b. Instead of putting the “dict.txt” in the...
Write a program that prompts the user to input a string. The program then uses the...
Write a program that prompts the user to input a string. The program then uses the function substr to remove all the vowels from the string. For example, if str=”There”, then after removing all the vowels, str=”Thr”. After removing all the vowels, output the string. Your program must contain a function to remove all the vowels and a function to determine whether a character is a vowel. You must insert the following comments at the beginning of your program and...
Write a Java application with a JavaFXGUI that takes a String input by the user and...
Write a Java application with a JavaFXGUI that takes a String input by the user and shows whether the string contains all 26 letters of the (English version of the Latin) alphabet. For example, "Pack my box with five dozen liquor jugs" contains all 26 letters, but "The quick frown box jumps over the hazy log" does not contain a d. It does not matter whether one or more letters appear more than once. The GUI needs, at minimum, a...
ADVERTISEMENT
ADVERTISEMENT
ADVERTISEMENT