Question

In: Chemistry

Calculate the pH of a solution starting with 200.0 mL of 0.010 M butanoic acid (pKa...

Calculate the pH of a solution starting with 200.0 mL of 0.010 M butanoic acid (pKa = 4.818) solution that has been titrated to the equivalence point with 0.050 M NaOH. Ignore activities and state your answer with 3 sig. figs. Use approximations if you can.

Solutions

Expert Solution

use:

pKa = -log Ka

4.818 = -log Ka

Ka = 1.521*10^-5

find the volume of NaOH used to reach equivalence point

M(C3H7COOH)*V(C3H7COOH) =M(NaOH)*V(NaOH)

0.01 M *200.0 mL = 0.05M *V(NaOH)

V(NaOH) = 40 mL

Given:

M(C3H7COOH) = 0.01 M

V(C3H7COOH) = 200 mL

M(NaOH) = 0.05 M

V(NaOH) = 40 mL

mol(C3H7COOH) = M(C3H7COOH) * V(C3H7COOH)

mol(C3H7COOH) = 0.01 M * 200 mL = 2 mmol

mol(NaOH) = M(NaOH) * V(NaOH)

mol(NaOH) = 0.05 M * 40 mL = 2 mmol

We have:

mol(C3H7COOH) = 2 mmol

mol(NaOH) = 2 mmol

2 mmol of both will react to form C3H7COO- and H2O

C3H7COO- here is strong base

C3H7COO- formed = 2 mmol

Volume of Solution = 200 + 40 = 240 mL

Kb of C3H7COO- = Kw/Ka = 1*10^-14/1.521*10^-5 = 6.577*10^-10

concentration ofC3H7COO-,c = 2 mmol/240 mL = 0.0083M

C3H7COO- dissociates as

C3H7COO- + H2O -----> C3H7COOH + OH-

0.0083 0 0

0.0083-x x x

Kb = [C3H7COOH][OH-]/[C3H7COO-]

Kb = x*x/(c-x)

Assuming x can be ignored as compared to c

So, above expression becomes

Kb = x*x/(c)

so, x = sqrt (Kb*c)

x = sqrt ((6.577*10^-10)*8.333*10^-3) = 2.341*10^-6

since c is much greater than x, our assumption is correct

so, x = 2.341*10^-6 M

[OH-] = x = 2.341*10^-6 M

use:

pOH = -log [OH-]

= -log (2.341*10^-6)

= 5.6306

use:

PH = 14 - pOH

= 14 - 5.6306

= 8.3694

Answer: 8.37


Related Solutions

Find the pH of a 30.0 ml butanoic acid ( HA) solution ( 0.600 M )...
Find the pH of a 30.0 ml butanoic acid ( HA) solution ( 0.600 M ) when you add the following volume of 0.600 M NaOH ( 5 points ). Ka of HA = 1.5 x 10-5 (a) 0.0 ml (b) 10.0 ml (c) 15.0 ml (d) 30.0 ml (e) 50.0 ml
a. What is the pKa of a 0.010 M solution with a pH of 5.24? b....
a. What is the pKa of a 0.010 M solution with a pH of 5.24? b. CaCO3 is dissolved in water. What is the complete charge balance equation for its dissolution?
25.000 mL of 0.1438 M butanoic acid solution is titrated with 0.1247 M NaOH. Calculate the...
25.000 mL of 0.1438 M butanoic acid solution is titrated with 0.1247 M NaOH. Calculate the pH of titrant mixture at the following volumes of NaOH added. Ka butanoic acid = 1.52 x 10^-5 a.) 0.00 mL b.) 16.04 mL c.) 28.83 mL (Equivalence point) d.) 30.30 mL My answers were: a.) 2.830 b.) 4.917 c.) 8.821 d.) 11.521
a) Calculate the pH of a 0.045 M potassium chlorite solution. (The pKa for chlorous acid...
a) Calculate the pH of a 0.045 M potassium chlorite solution. (The pKa for chlorous acid is 1.92) b) Calculate the pH of a solution that is 0.35 M hydroxylamine and 0.50 M hydroxylammonium chloride, (The pKb for hydroxylamine is 7.96)
what is the pH of a solution that mixes 30.00 mL of 0.010 M Ch3oh with...
what is the pH of a solution that mixes 30.00 mL of 0.010 M Ch3oh with 30.00 mL 0.00750 M Nach3co2?
A 200.0 mL buffer solution is 0.260 M in acetic acid and 0.260 M in sodium...
A 200.0 mL buffer solution is 0.260 M in acetic acid and 0.260 M in sodium acetate. 1) What is the initial pH of this solution? 2) What is the pH after addition of 0.0100 mol of HCl? 3) What is the pH after addition of 0.0100 mol of NaOH?
Consider the titration of 50.0 mL of a 0.0200 M solution of butanoic acid with 0.100...
Consider the titration of 50.0 mL of a 0.0200 M solution of butanoic acid with 0.100 M NaOH. First, calculate the equivalence point (Ve). Then, calculate the pH at the following points along the titration curve. Assume fractions are exact numbers and ignore activities for all calculations in this problem. A) VNaOH= 0.000 mL B) VNaOH= 1/2Ve C) VNaOH= 4/5Ve D) VNaOH= Ve E) VNaOH= 3/2Ve
Calculate the percent ionization of formic acid in a solution that is 0.010 M HCOOH and...
Calculate the percent ionization of formic acid in a solution that is 0.010 M HCOOH and 0.005 M HCOONa. Ka (HCOOH) = 1.7x10-4 ? 3.4% is correct answer
Calculate the pH for 300. mL of a 0.850 M solution of the benzoic acid, (C6H5COOH),...
Calculate the pH for 300. mL of a 0.850 M solution of the benzoic acid, (C6H5COOH), Ka=6.30x10-5 ) being titrated with 0.850 M NaOH at the following positions in the titration. a) The initial pH (before any NaOH has been added). a. 1.436 b. 12.864 c. 5.435 d. 8.534 e. 2.136 b) The pH of the solution after 125.0 mL of 0.850 M NaOH has been added. a. 10.034 b. 4.054 c. 3.543 d. 8.534 e. 2.132 c) The pH...
A chemist titrates 210.0 mL of a 0.7560 M butanoic acid (HC3H7CO2) solution with 0.6335 M...
A chemist titrates 210.0 mL of a 0.7560 M butanoic acid (HC3H7CO2) solution with 0.6335 M KOH solution at 25 degrees celsius. Calculate the pH at equivalence. The pKa of butanoic acid is 4.82. Round your answer to 2 decimal places please
ADVERTISEMENT
ADVERTISEMENT
ADVERTISEMENT